About barium(2+);bis(3-oxobutanoate)
barium(2+);bis(3-oxobutanoate) (PubChem CID 87577047) has the molecular formula C8H10BaO6
and a molecular weight of 339.49 g/mol. Its IUPAC name is barium(2+);bis(3-oxobutanoate).
Molecular Properties
| Compound Name | barium(2+);bis(3-oxobutanoate) |
| PubChem CID | 87577047 |
| Molecular Formula | C8H10BaO6 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | barium(2+);bis(3-oxobutanoate) |
| SMILES | CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C4H6O3.Ba/c2*1-3(5)2-4(6)7;/h2*2H2,1H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | VPYPCHSGWXCVII-UHFFFAOYSA-L |
| XLogP | -2.95 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(3-oxobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(3-oxobutanoate)?
The IUPAC name of barium(2+);bis(3-oxobutanoate) (CID 87577047) is barium(2+);bis(3-oxobutanoate).
What is the SMILES notation for barium(2+);bis(3-oxobutanoate)?
The canonical SMILES for barium(2+);bis(3-oxobutanoate) is CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(3-oxobutanoate)?
The InChIKey is VPYPCHSGWXCVII-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6O3.Ba/c2*1-3(5)2-4(6)7;/h2*2H2,1H3,(H,6,7);/q;;+2/p-2.
What are the key properties of barium(2+);bis(3-oxobutanoate)?
barium(2+);bis(3-oxobutanoate) has a molecular weight of 339.49 g/mol, XLogP of -2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(3-oxobutanoate) is sourced from PubChem (CID 87577047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).