About bis(3-oxobutanoate);propylaluminum(2+)
bis(3-oxobutanoate);propylaluminum(2+) (PubChem CID 175370706) has the molecular formula C11H17AlO6
and a molecular weight of 272.23 g/mol. Its IUPAC name is bis(3-oxobutanoate);propylaluminum(2+).
Molecular Properties
| Compound Name | bis(3-oxobutanoate);propylaluminum(2+) |
| PubChem CID | 175370706 |
| Molecular Formula | C11H17AlO6 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | bis(3-oxobutanoate);propylaluminum(2+) |
| SMILES | CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CCC[Al+2] |
| InChI | InChI=1S/2C4H6O3.C3H7.Al/c2*1-3(5)2-4(6)7;1-3-2;/h2*2H2,1H3,(H,6,7);1,3H2,2H3;/q;;;+2/p-2 |
| InChIKey | BCDBVBYJRBMSSR-UHFFFAOYSA-L |
| XLogP | -1.59 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(3-oxobutanoate);propylaluminum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxobutanoate);propylaluminum(2+)?
The IUPAC name of bis(3-oxobutanoate);propylaluminum(2+) (CID 175370706) is bis(3-oxobutanoate);propylaluminum(2+).
What is the SMILES notation for bis(3-oxobutanoate);propylaluminum(2+)?
The canonical SMILES for bis(3-oxobutanoate);propylaluminum(2+) is CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CCC[Al+2].
What is the InChIKey of bis(3-oxobutanoate);propylaluminum(2+)?
The InChIKey is BCDBVBYJRBMSSR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6O3.C3H7.Al/c2*1-3(5)2-4(6)7;1-3-2;/h2*2H2,1H3,(H,6,7);1,3H2,2H3;/q;;;+2/p-2.
What are the key properties of bis(3-oxobutanoate);propylaluminum(2+)?
bis(3-oxobutanoate);propylaluminum(2+) has a molecular weight of 272.23 g/mol, XLogP of -1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxobutanoate);propylaluminum(2+) is sourced from PubChem (CID 175370706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).