About 3-oxobutanoate;prop-2-enoate
3-oxobutanoate;prop-2-enoate (PubChem CID 21216987) has the molecular formula C7H8O5-2
and a molecular weight of 172.14 g/mol. Its IUPAC name is 3-oxobutanoate;prop-2-enoate.
Molecular Properties
| Compound Name | 3-oxobutanoate;prop-2-enoate |
| PubChem CID | 21216987 |
| Molecular Formula | C7H8O5-2 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-oxobutanoate;prop-2-enoate |
| SMILES | C=CC(=O)[O-].CC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C4H6O3.C3H4O2/c1-3(5)2-4(6)7;1-2-3(4)5/h2H2,1H3,(H,6,7);2H,1H2,(H,4,5)/p-2 |
| InChIKey | TYPOKIZTFXSDNV-UHFFFAOYSA-L |
| XLogP | -2.36 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoate;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoate;prop-2-enoate?
The IUPAC name of 3-oxobutanoate;prop-2-enoate (CID 21216987) is 3-oxobutanoate;prop-2-enoate.
What is the SMILES notation for 3-oxobutanoate;prop-2-enoate?
The canonical SMILES for 3-oxobutanoate;prop-2-enoate is C=CC(=O)[O-].CC(=O)CC(=O)[O-].
What is the InChIKey of 3-oxobutanoate;prop-2-enoate?
The InChIKey is TYPOKIZTFXSDNV-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O3.C3H4O2/c1-3(5)2-4(6)7;1-2-3(4)5/h2H2,1H3,(H,6,7);2H,1H2,(H,4,5)/p-2.
What are the key properties of 3-oxobutanoate;prop-2-enoate?
3-oxobutanoate;prop-2-enoate has a molecular weight of 172.14 g/mol, XLogP of -2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoate;prop-2-enoate is sourced from PubChem (CID 21216987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).