About cobalt(3+);3-oxobutanoate;bis(propan-2-olate)
cobalt(3+);3-oxobutanoate;bis(propan-2-olate) (PubChem CID 173419525) has the molecular formula C10H19CoO5
and a molecular weight of 278.19 g/mol. Its IUPAC name is cobalt(3+);3-oxobutanoate;bis(propan-2-olate).
Molecular Properties
| Compound Name | cobalt(3+);3-oxobutanoate;bis(propan-2-olate) |
| PubChem CID | 173419525 |
| Molecular Formula | C10H19CoO5 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | cobalt(3+);3-oxobutanoate;bis(propan-2-olate) |
| SMILES | CC(=O)CC(=O)[O-].CC(C)[O-].CC(C)[O-].[Co+3] |
| InChI | InChI=1S/C4H6O3.2C3H7O.Co/c1-3(5)2-4(6)7;2*1-3(2)4;/h2H2,1H3,(H,6,7);2*3H,1-2H3;/q;2*-1;+3/p-1 |
| InChIKey | FVCLJGYIKJAUCI-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cobalt(3+);3-oxobutanoate;bis(propan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(3+);3-oxobutanoate;bis(propan-2-olate)?
The IUPAC name of cobalt(3+);3-oxobutanoate;bis(propan-2-olate) (CID 173419525) is cobalt(3+);3-oxobutanoate;bis(propan-2-olate).
What is the SMILES notation for cobalt(3+);3-oxobutanoate;bis(propan-2-olate)?
The canonical SMILES for cobalt(3+);3-oxobutanoate;bis(propan-2-olate) is CC(=O)CC(=O)[O-].CC(C)[O-].CC(C)[O-].[Co+3].
What is the InChIKey of cobalt(3+);3-oxobutanoate;bis(propan-2-olate)?
The InChIKey is FVCLJGYIKJAUCI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3.2C3H7O.Co/c1-3(5)2-4(6)7;2*1-3(2)4;/h2H2,1H3,(H,6,7);2*3H,1-2H3;/q;2*-1;+3/p-1.
What are the key properties of cobalt(3+);3-oxobutanoate;bis(propan-2-olate)?
cobalt(3+);3-oxobutanoate;bis(propan-2-olate) has a molecular weight of 278.19 g/mol, XLogP of -1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(3+);3-oxobutanoate;bis(propan-2-olate) is sourced from PubChem (CID 173419525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).