About tris(2-aminoacetate);propan-2-olate;titanium(4+)
tris(2-aminoacetate);propan-2-olate;titanium(4+) (PubChem CID 138401384) has the molecular formula C9H19N3O7Ti
and a molecular weight of 329.13 g/mol. Its IUPAC name is tris(2-aminoacetate);propan-2-olate;titanium(4+).
Molecular Properties
| Compound Name | tris(2-aminoacetate);propan-2-olate;titanium(4+) |
| PubChem CID | 138401384 |
| Molecular Formula | C9H19N3O7Ti |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | tris(2-aminoacetate);propan-2-olate;titanium(4+) |
| SMILES | CC(C)[O-].NCC(=O)[O-].NCC(=O)[O-].NCC(=O)[O-].[Ti+4] |
| InChI | InChI=1S/C3H7O.3C2H5NO2.Ti/c1-3(2)4;3*3-1-2(4)5;/h3H,1-2H3;3*1,3H2,(H,4,5);/q-1;;;;+4/p-3 |
| InChIKey | FGNWDHMCWJNIAZ-UHFFFAOYSA-K |
| XLogP | -7.16 |
| TPSA | 221.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | -7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze tris(2-aminoacetate);propan-2-olate;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-aminoacetate);propan-2-olate;titanium(4+)?
The IUPAC name of tris(2-aminoacetate);propan-2-olate;titanium(4+) (CID 138401384) is tris(2-aminoacetate);propan-2-olate;titanium(4+).
What is the SMILES notation for tris(2-aminoacetate);propan-2-olate;titanium(4+)?
The canonical SMILES for tris(2-aminoacetate);propan-2-olate;titanium(4+) is CC(C)[O-].NCC(=O)[O-].NCC(=O)[O-].NCC(=O)[O-].[Ti+4].
What is the InChIKey of tris(2-aminoacetate);propan-2-olate;titanium(4+)?
The InChIKey is FGNWDHMCWJNIAZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7O.3C2H5NO2.Ti/c1-3(2)4;3*3-1-2(4)5;/h3H,1-2H3;3*1,3H2,(H,4,5);/q-1;;;;+4/p-3.
What are the key properties of tris(2-aminoacetate);propan-2-olate;titanium(4+)?
tris(2-aminoacetate);propan-2-olate;titanium(4+) has a molecular weight of 329.13 g/mol, XLogP of -7.16, 3 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-aminoacetate);propan-2-olate;titanium(4+) is sourced from PubChem (CID 138401384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).