About diazanium;propan-2-olate;acetate
diazanium;propan-2-olate;acetate (PubChem CID 141066617) has the molecular formula C5H18N2O3
and a molecular weight of 154.21 g/mol. Its IUPAC name is diazanium;propan-2-olate;acetate.
Molecular Properties
| Compound Name | diazanium;propan-2-olate;acetate |
| PubChem CID | 141066617 |
| Molecular Formula | C5H18N2O3 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.13 |
| IUPAC Name | diazanium;propan-2-olate;acetate |
| SMILES | CC(=O)[O-].CC(C)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H7O.C2H4O2.2H3N/c1-3(2)4;1-2(3)4;;/h3H,1-2H3;1H3,(H,3,4);2*1H3/q-1;;;/p+1 |
| InChIKey | DOPWVIFTXFBMFX-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diazanium;propan-2-olate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;propan-2-olate;acetate?
The IUPAC name of diazanium;propan-2-olate;acetate (CID 141066617) is diazanium;propan-2-olate;acetate.
What is the SMILES notation for diazanium;propan-2-olate;acetate?
The canonical SMILES for diazanium;propan-2-olate;acetate is CC(=O)[O-].CC(C)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;propan-2-olate;acetate?
The InChIKey is DOPWVIFTXFBMFX-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7O.C2H4O2.2H3N/c1-3(2)4;1-2(3)4;;/h3H,1-2H3;1H3,(H,3,4);2*1H3/q-1;;;/p+1.
What are the key properties of diazanium;propan-2-olate;acetate?
diazanium;propan-2-olate;acetate has a molecular weight of 154.21 g/mol, XLogP of -0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;propan-2-olate;acetate is sourced from PubChem (CID 141066617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).