C12H17O3Rh- — CID 159127896
cycloocta-1,5-diene;3-oxobutanoate;rhodium (PubChem CID 159127896) has the molecular formula C12H17O3Rh- and a molecular weight of 312.17 g/mol. Its IUPAC name is cycloocta-1,5-diene;3-oxobutanoate;rhodium.
| Compound Name | cycloocta-1,5-diene;3-oxobutanoate;rhodium |
|---|---|
| PubChem CID | 159127896 |
| Molecular Formula | C12H17O3Rh- |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | cycloocta-1,5-diene;3-oxobutanoate;rhodium |
| SMILES | C1=CCCC=CCC1.CC(=O)CC(=O)[O-].[Rh] |
| InChI | InChI=1S/C8H12.C4H6O3.Rh/c1-2-4-6-8-7-5-3-1;1-3(5)2-4(6)7;/h1-2,7-8H,3-6H2;2H2,1H3,(H,6,7);/p-1 |
| InChIKey | TZMLJPJQNSHJNN-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|