C10H20NO3- — CID 19857191
N,N-diethylethanamine;3-oxobutanoate (PubChem CID 19857191) has the molecular formula C10H20NO3- and a molecular weight of 202.27 g/mol. Its IUPAC name is N,N-diethylethanamine;3-oxobutanoate.
| Compound Name | N,N-diethylethanamine;3-oxobutanoate |
|---|---|
| PubChem CID | 19857191 |
| Molecular Formula | C10H20NO3- |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | N,N-diethylethanamine;3-oxobutanoate |
| SMILES | CC(=O)CC(=O)[O-].CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H6O3/c1-4-7(5-2)6-3;1-3(5)2-4(6)7/h4-6H2,1-3H3;2H2,1H3,(H,6,7)/p-1 |
| InChIKey | QIZZJBMDZWWXBV-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|