C12H23NO4-2 — CID 23047096
N,N-diethylethanamine;2-methylprop-2-enoate;acetate (PubChem CID 23047096) has the molecular formula C12H23NO4-2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N,N-diethylethanamine;2-methylprop-2-enoate;acetate.
| Compound Name | N,N-diethylethanamine;2-methylprop-2-enoate;acetate |
|---|---|
| PubChem CID | 23047096 |
| Molecular Formula | C12H23NO4-2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N,N-diethylethanamine;2-methylprop-2-enoate;acetate |
| SMILES | C=C(C)C(=O)[O-].CC(=O)[O-].CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H6O2.C2H4O2/c1-4-7(5-2)6-3;1-3(2)4(5)6;1-2(3)4/h4-6H2,1-3H3;1H2,2H3,(H,5,6);1H3,(H,3,4)/p-2 |
| InChIKey | JBVOETOYYUGASV-UHFFFAOYSA-L |
| XLogP | -0.58 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|