About cadmium(2+);2-(diethylamino)ethanethiol;diacetate
cadmium(2+);2-(diethylamino)ethanethiol;diacetate (PubChem CID 157171436) has the molecular formula C10H21CdNO4S
and a molecular weight of 363.76 g/mol. Its IUPAC name is cadmium(2+);2-(diethylamino)ethanethiol;diacetate.
Molecular Properties
| Compound Name | cadmium(2+);2-(diethylamino)ethanethiol;diacetate |
| PubChem CID | 157171436 |
| Molecular Formula | C10H21CdNO4S |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | cadmium(2+);2-(diethylamino)ethanethiol;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CCN(CC)CCS.[Cd+2] |
| InChI | InChI=1S/C6H15NS.2C2H4O2.Cd/c1-3-7(4-2)5-6-8;2*1-2(3)4;/h8H,3-6H2,1-2H3;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | ANMYPDVXRYKWTK-UHFFFAOYSA-L |
| XLogP | -1.23 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);2-(diethylamino)ethanethiol;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);2-(diethylamino)ethanethiol;diacetate?
The IUPAC name of cadmium(2+);2-(diethylamino)ethanethiol;diacetate (CID 157171436) is cadmium(2+);2-(diethylamino)ethanethiol;diacetate.
What is the SMILES notation for cadmium(2+);2-(diethylamino)ethanethiol;diacetate?
The canonical SMILES for cadmium(2+);2-(diethylamino)ethanethiol;diacetate is CC(=O)[O-].CC(=O)[O-].CCN(CC)CCS.[Cd+2].
What is the InChIKey of cadmium(2+);2-(diethylamino)ethanethiol;diacetate?
The InChIKey is ANMYPDVXRYKWTK-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H15NS.2C2H4O2.Cd/c1-3-7(4-2)5-6-8;2*1-2(3)4;/h8H,3-6H2,1-2H3;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of cadmium(2+);2-(diethylamino)ethanethiol;diacetate?
cadmium(2+);2-(diethylamino)ethanethiol;diacetate has a molecular weight of 363.76 g/mol, XLogP of -1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);2-(diethylamino)ethanethiol;diacetate is sourced from PubChem (CID 157171436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).