About dibutyltin(2+);bis(3-oxobutanoate)
dibutyltin(2+);bis(3-oxobutanoate) (PubChem CID 22571283) has the molecular formula C16H28O6Sn
and a molecular weight of 435.11 g/mol. Its IUPAC name is dibutyltin(2+);bis(3-oxobutanoate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis(3-oxobutanoate) |
| PubChem CID | 22571283 |
| Molecular Formula | C16H28O6Sn |
| Molecular Weight | 435.11 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | dibutyltin(2+);bis(3-oxobutanoate) |
| SMILES | CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C4H6O3.2C4H9.Sn/c2*1-3(5)2-4(6)7;2*1-3-4-2;/h2*2H2,1H3,(H,6,7);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | DIEUSOPNGAEVNO-UHFFFAOYSA-L |
| XLogP | 0.56 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.11 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis(3-oxobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis(3-oxobutanoate)?
The IUPAC name of dibutyltin(2+);bis(3-oxobutanoate) (CID 22571283) is dibutyltin(2+);bis(3-oxobutanoate).
What is the SMILES notation for dibutyltin(2+);bis(3-oxobutanoate)?
The canonical SMILES for dibutyltin(2+);bis(3-oxobutanoate) is CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CCCC[Sn+2]CCCC.
What is the InChIKey of dibutyltin(2+);bis(3-oxobutanoate)?
The InChIKey is DIEUSOPNGAEVNO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6O3.2C4H9.Sn/c2*1-3(5)2-4(6)7;2*1-3-4-2;/h2*2H2,1H3,(H,6,7);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of dibutyltin(2+);bis(3-oxobutanoate)?
dibutyltin(2+);bis(3-oxobutanoate) has a molecular weight of 435.11 g/mol, XLogP of 0.56, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis(3-oxobutanoate) is sourced from PubChem (CID 22571283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).