About dioctyltin(2+);bis(3-oxohexanoate)
dioctyltin(2+);bis(3-oxohexanoate) (PubChem CID 158688207) has the molecular formula C28H52O6Sn
and a molecular weight of 603.43 g/mol. Its IUPAC name is dioctyltin(2+);bis(3-oxohexanoate).
Molecular Properties
| Compound Name | dioctyltin(2+);bis(3-oxohexanoate) |
| PubChem CID | 158688207 |
| Molecular Formula | C28H52O6Sn |
| Molecular Weight | 603.43 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | dioctyltin(2+);bis(3-oxohexanoate) |
| SMILES | CCCC(=O)CC(=O)[O-].CCCC(=O)CC(=O)[O-].CCCCCCCC[Sn+2]CCCCCCCC |
| InChI | InChI=1S/2C8H17.2C6H10O3.Sn/c2*1-3-5-7-8-6-4-2;2*1-2-3-5(7)4-6(8)9;/h2*1,3-8H2,2H3;2*2-4H2,1H3,(H,8,9);/q;;;;+2/p-2 |
| InChIKey | IFZWFELZASNILU-UHFFFAOYSA-L |
| XLogP | 5.24 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dioctyltin(2+);bis(3-oxohexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyltin(2+);bis(3-oxohexanoate)?
The IUPAC name of dioctyltin(2+);bis(3-oxohexanoate) (CID 158688207) is dioctyltin(2+);bis(3-oxohexanoate).
What is the SMILES notation for dioctyltin(2+);bis(3-oxohexanoate)?
The canonical SMILES for dioctyltin(2+);bis(3-oxohexanoate) is CCCC(=O)CC(=O)[O-].CCCC(=O)CC(=O)[O-].CCCCCCCC[Sn+2]CCCCCCCC.
What is the InChIKey of dioctyltin(2+);bis(3-oxohexanoate)?
The InChIKey is IFZWFELZASNILU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H17.2C6H10O3.Sn/c2*1-3-5-7-8-6-4-2;2*1-2-3-5(7)4-6(8)9;/h2*1,3-8H2,2H3;2*2-4H2,1H3,(H,8,9);/q;;;;+2/p-2.
What are the key properties of dioctyltin(2+);bis(3-oxohexanoate)?
dioctyltin(2+);bis(3-oxohexanoate) has a molecular weight of 603.43 g/mol, XLogP of 5.24, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyltin(2+);bis(3-oxohexanoate) is sourced from PubChem (CID 158688207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).