About sodium 3-oxooctadecanoate
sodium 3-oxooctadecanoate (PubChem CID 155047798) has the molecular formula C18H33NaO3
and a molecular weight of 320.45 g/mol. Its IUPAC name is sodium 3-oxooctadecanoate.
Molecular Properties
| Compound Name | sodium 3-oxooctadecanoate |
| PubChem CID | 155047798 |
| Molecular Formula | C18H33NaO3 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | sodium 3-oxooctadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H34O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21;/h2-16H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | WLQDQYQOMDUCLF-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-oxooctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-oxooctadecanoate?
The IUPAC name of sodium 3-oxooctadecanoate (CID 155047798) is sodium 3-oxooctadecanoate.
What is the SMILES notation for sodium 3-oxooctadecanoate?
The canonical SMILES for sodium 3-oxooctadecanoate is CCCCCCCCCCCCCCCC(=O)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3-oxooctadecanoate?
The InChIKey is WLQDQYQOMDUCLF-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H34O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21;/h2-16H2,1H3,(H,20,21);/q;+1/p-1.
What are the key properties of sodium 3-oxooctadecanoate?
sodium 3-oxooctadecanoate has a molecular weight of 320.45 g/mol, XLogP of 1.18, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-oxooctadecanoate is sourced from PubChem (CID 155047798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).