About aluminum;3-oxodocosanoate;bis(propan-2-olate)
aluminum;3-oxodocosanoate;bis(propan-2-olate) (PubChem CID 175492518) has the molecular formula C28H55AlO5
and a molecular weight of 498.73 g/mol. Its IUPAC name is aluminum;3-oxodocosanoate;bis(propan-2-olate).
Molecular Properties
| Compound Name | aluminum;3-oxodocosanoate;bis(propan-2-olate) |
| PubChem CID | 175492518 |
| Molecular Formula | C28H55AlO5 |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | aluminum;3-oxodocosanoate;bis(propan-2-olate) |
| SMILES | CC(C)[O-].CC(C)[O-].CCCCCCCCCCCCCCCCCCCC(=O)CC(=O)[O-].[Al+3] |
| InChI | InChI=1S/C22H42O3.2C3H7O.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25;2*1-3(2)4;/h2-20H2,1H3,(H,24,25);2*3H,1-2H3;/q;2*-1;+3/p-1 |
| InChIKey | LAEDSOSBUOPRPM-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze aluminum;3-oxodocosanoate;bis(propan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;3-oxodocosanoate;bis(propan-2-olate)?
The IUPAC name of aluminum;3-oxodocosanoate;bis(propan-2-olate) (CID 175492518) is aluminum;3-oxodocosanoate;bis(propan-2-olate).
What is the SMILES notation for aluminum;3-oxodocosanoate;bis(propan-2-olate)?
The canonical SMILES for aluminum;3-oxodocosanoate;bis(propan-2-olate) is CC(C)[O-].CC(C)[O-].CCCCCCCCCCCCCCCCCCCC(=O)CC(=O)[O-].[Al+3].
What is the InChIKey of aluminum;3-oxodocosanoate;bis(propan-2-olate)?
The InChIKey is LAEDSOSBUOPRPM-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H42O3.2C3H7O.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25;2*1-3(2)4;/h2-20H2,1H3,(H,24,25);2*3H,1-2H3;/q;2*-1;+3/p-1.
What are the key properties of aluminum;3-oxodocosanoate;bis(propan-2-olate)?
aluminum;3-oxodocosanoate;bis(propan-2-olate) has a molecular weight of 498.73 g/mol, XLogP of 4.87, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;3-oxodocosanoate;bis(propan-2-olate) is sourced from PubChem (CID 175492518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).