About 3-oxohexanoate;tris(propan-2-olate);zirconium(4+)
3-oxohexanoate;tris(propan-2-olate);zirconium(4+) (PubChem CID 159896496) has the molecular formula C15H30O6Zr
and a molecular weight of 397.62 g/mol. Its IUPAC name is 3-oxohexanoate;tris(propan-2-olate);zirconium(4+).
Molecular Properties
| Compound Name | 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) |
| PubChem CID | 159896496 |
| Molecular Formula | C15H30O6Zr |
| Molecular Weight | 397.62 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].CCCC(=O)CC(=O)[O-].[Zr+4] |
| InChI | InChI=1S/C6H10O3.3C3H7O.Zr/c1-2-3-5(7)4-6(8)9;3*1-3(2)4;/h2-4H2,1H3,(H,8,9);3*3H,1-2H3;/q;3*-1;+4/p-1 |
| InChIKey | NVKFPDJJHWGQBV-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.62 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexanoate;tris(propan-2-olate);zirconium(4+)?
The IUPAC name of 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) (CID 159896496) is 3-oxohexanoate;tris(propan-2-olate);zirconium(4+).
What is the SMILES notation for 3-oxohexanoate;tris(propan-2-olate);zirconium(4+)?
The canonical SMILES for 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) is CC(C)[O-].CC(C)[O-].CC(C)[O-].CCCC(=O)CC(=O)[O-].[Zr+4].
What is the InChIKey of 3-oxohexanoate;tris(propan-2-olate);zirconium(4+)?
The InChIKey is NVKFPDJJHWGQBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O3.3C3H7O.Zr/c1-2-3-5(7)4-6(8)9;3*1-3(2)4;/h2-4H2,1H3,(H,8,9);3*3H,1-2H3;/q;3*-1;+4/p-1.
What are the key properties of 3-oxohexanoate;tris(propan-2-olate);zirconium(4+)?
3-oxohexanoate;tris(propan-2-olate);zirconium(4+) has a molecular weight of 397.62 g/mol, XLogP of -1.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexanoate;tris(propan-2-olate);zirconium(4+) is sourced from PubChem (CID 159896496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).