About bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+)
bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) (PubChem CID 173122638) has the molecular formula C21H34O10Ti
and a molecular weight of 494.36 g/mol. Its IUPAC name is bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+).
Molecular Properties
| Compound Name | bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) |
| PubChem CID | 173122638 |
| Molecular Formula | C21H34O10Ti |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) |
| SMILES | CCCC(=O)CC(=O)OOC(C)C.CCCC(=O)CC(=O)[O-].CCCC(=O)CC(=O)[O-].[Ti+2] |
| InChI | InChI=1S/C9H16O4.2C6H10O3.Ti/c1-4-5-8(10)6-9(11)13-12-7(2)3;2*1-2-3-5(7)4-6(8)9;/h7H,4-6H2,1-3H3;2*2-4H2,1H3,(H,8,9);/q;;;+2/p-2 |
| InChIKey | HASKUAXHCKKZQH-UHFFFAOYSA-L |
| XLogP | 0.62 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+)?
The IUPAC name of bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) (CID 173122638) is bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+).
What is the SMILES notation for bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+)?
The canonical SMILES for bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) is CCCC(=O)CC(=O)OOC(C)C.CCCC(=O)CC(=O)[O-].CCCC(=O)CC(=O)[O-].[Ti+2].
What is the InChIKey of bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+)?
The InChIKey is HASKUAXHCKKZQH-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16O4.2C6H10O3.Ti/c1-4-5-8(10)6-9(11)13-12-7(2)3;2*1-2-3-5(7)4-6(8)9;/h7H,4-6H2,1-3H3;2*2-4H2,1H3,(H,8,9);/q;;;+2/p-2.
What are the key properties of bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+)?
bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) has a molecular weight of 494.36 g/mol, XLogP of 0.62, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxohexanoate);propan-2-yl 3-oxohexaneperoxoate;titanium(2+) is sourced from PubChem (CID 173122638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).