C19H32O7Sn — CID 23184164
dibutyltin(2+);2,4-dioxopentanoate;2-ethyl-3-oxobutanoate (PubChem CID 23184164) has the molecular formula C19H32O7Sn and a molecular weight of 491.17 g/mol. Its IUPAC name is dibutyltin(2+);2,4-dioxopentanoate;2-ethyl-3-oxobutanoate.
| Compound Name | dibutyltin(2+);2,4-dioxopentanoate;2-ethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 23184164 |
| Molecular Formula | C19H32O7Sn |
| Molecular Weight | 491.17 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | dibutyltin(2+);2,4-dioxopentanoate;2-ethyl-3-oxobutanoate |
| SMILES | CC(=O)CC(=O)C(=O)[O-].CCC(C(C)=O)C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/C6H10O3.C5H6O4.2C4H9.Sn/c1-3-5(4(2)7)6(8)9;1-3(6)2-4(7)5(8)9;2*1-3-4-2;/h5H,3H2,1-2H3,(H,8,9);2H2,1H3,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | FZFFFGZHVHGSMP-UHFFFAOYSA-L |
| XLogP | 0.76 |
| TPSA | 131.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|