About 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)
2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) (PubChem CID 87420793) has the molecular formula C20H35AlO7
and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate).
Molecular Properties
| Compound Name | 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) |
| PubChem CID | 87420793 |
| Molecular Formula | C20H35AlO7 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) |
| SMILES | CCC(C(C)=O)C(=O)[O-].CCC(C(C)=O)C(=O)[O-].CCCCC(CC)CO[Al+2] |
| InChI | InChI=1S/C8H17O.2C6H10O3.Al/c1-3-5-6-8(4-2)7-9;2*1-3-5(4(2)7)6(8)9;/h8H,3-7H2,1-2H3;2*5H,3H2,1-2H3,(H,8,9);/q-1;;;+3/p-2 |
| InChIKey | JBQNOKMGDSRZIJ-UHFFFAOYSA-L |
| XLogP | 1.01 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The IUPAC name of 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) (CID 87420793) is 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate).
What is the SMILES notation for 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The canonical SMILES for 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) is CCC(C(C)=O)C(=O)[O-].CCC(C(C)=O)C(=O)[O-].CCCCC(CC)CO[Al+2].
What is the InChIKey of 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The InChIKey is JBQNOKMGDSRZIJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H17O.2C6H10O3.Al/c1-3-5-6-8(4-2)7-9;2*1-3-5(4(2)7)6(8)9;/h8H,3-7H2,1-2H3;2*5H,3H2,1-2H3,(H,8,9);/q-1;;;+3/p-2.
What are the key properties of 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) has a molecular weight of 414.48 g/mol, XLogP of 1.01, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) is sourced from PubChem (CID 87420793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).