About 2-(2-ethylhexoxy)acetic acid
2-(2-ethylhexoxy)acetic acid (PubChem CID 11651287) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(2-ethylhexoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(2-ethylhexoxy)acetic acid |
| PubChem CID | 11651287 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-(2-ethylhexoxy)acetic acid |
| SMILES | CCCCC(CC)COCC(=O)O |
| InChI | InChI=1S/C10H20O3/c1-3-5-6-9(4-2)7-13-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | JSKVIEVGEWNVBN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-ethylhexoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylhexoxy)acetic acid?
The IUPAC name of 2-(2-ethylhexoxy)acetic acid (CID 11651287) is 2-(2-ethylhexoxy)acetic acid.
What is the SMILES notation for 2-(2-ethylhexoxy)acetic acid?
The canonical SMILES for 2-(2-ethylhexoxy)acetic acid is CCCCC(CC)COCC(=O)O.
What is the InChIKey of 2-(2-ethylhexoxy)acetic acid?
The InChIKey is JSKVIEVGEWNVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-3-5-6-9(4-2)7-13-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12).
What are the key properties of 2-(2-ethylhexoxy)acetic acid?
2-(2-ethylhexoxy)acetic acid has a molecular weight of 188.27 g/mol, XLogP of 2.30, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylhexoxy)acetic acid is sourced from PubChem (CID 11651287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).