About 2-ethylhexoxymethanol
2-ethylhexoxymethanol (PubChem CID 18783221) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 2-ethylhexoxymethanol.
Molecular Properties
| Compound Name | 2-ethylhexoxymethanol |
| PubChem CID | 18783221 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 2-ethylhexoxymethanol |
| SMILES | CCCCC(CC)COCO |
| InChI | InChI=1S/C9H20O2/c1-3-5-6-9(4-2)7-11-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | CVLNZEOVZXKLKQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexoxymethanol?
The IUPAC name of 2-ethylhexoxymethanol (CID 18783221) is 2-ethylhexoxymethanol.
What is the SMILES notation for 2-ethylhexoxymethanol?
The canonical SMILES for 2-ethylhexoxymethanol is CCCCC(CC)COCO.
What is the InChIKey of 2-ethylhexoxymethanol?
The InChIKey is CVLNZEOVZXKLKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-3-5-6-9(4-2)7-11-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 2-ethylhexoxymethanol?
2-ethylhexoxymethanol has a molecular weight of 160.26 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexoxymethanol is sourced from PubChem (CID 18783221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).