C11H24O3 — CID 73416378
(2R)-3-[(2R)-2-ethylhexoxy]propane-1,2-diol (PubChem CID 73416378) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is (2R)-3-[(2R)-2-ethylhexoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(2R)-2-ethylhexoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 73416378 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (2R)-3-[(2R)-2-ethylhexoxy]propane-1,2-diol |
| SMILES | CCCC[C@@H](CC)COC[C@H](O)CO |
| InChI | InChI=1S/C11H24O3/c1-3-5-6-10(4-2)8-14-9-11(13)7-12/h10-13H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | NCZPCONIKBICGS-GHMZBOCLSA-N |
| XLogP | 1.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |