C13H28O3 — CID 23105906
3-(2-ethyloctoxy)propane-1,2-diol (PubChem CID 23105906) has the molecular formula C13H28O3 and a molecular weight of 232.36 g/mol. Its IUPAC name is 3-(2-ethyloctoxy)propane-1,2-diol.
| Compound Name | 3-(2-ethyloctoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 23105906 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 3-(2-ethyloctoxy)propane-1,2-diol |
| SMILES | CCCCCCC(CC)COCC(O)CO |
| InChI | InChI=1S/C13H28O3/c1-3-5-6-7-8-12(4-2)10-16-11-13(15)9-14/h12-15H,3-11H2,1-2H3 |
| InChIKey | BSRIYBZCMGMEPA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|