C22H48O6 — CID 158933323
3-(2-ethylhexoxy)propane-1,2-diol;5-ethylnonane-1,2,3-triol (PubChem CID 158933323) has the molecular formula C22H48O6 and a molecular weight of 408.62 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)propane-1,2-diol;5-ethylnonane-1,2,3-triol.
| Compound Name | 3-(2-ethylhexoxy)propane-1,2-diol;5-ethylnonane-1,2,3-triol |
|---|---|
| PubChem CID | 158933323 |
| Molecular Formula | C22H48O6 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 3-(2-ethylhexoxy)propane-1,2-diol;5-ethylnonane-1,2,3-triol |
| SMILES | CCCCC(CC)CC(O)C(O)CO.CCCCC(CC)COCC(O)CO |
| InChI | InChI=1S/2C11H24O3/c1-3-5-6-10(4-2)8-14-9-11(13)7-12;1-3-5-6-9(4-2)7-10(13)11(14)8-12/h10-13H,3-9H2,1-2H3;9-14H,3-8H2,1-2H3 |
| InChIKey | JJILTPFZKIPGQX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |