C15H34O4 — CID 87069112
ethoxyethane;3-(2-ethylhexoxy)propane-1,2-diol (PubChem CID 87069112) has the molecular formula C15H34O4 and a molecular weight of 278.43 g/mol. Its IUPAC name is ethoxyethane;3-(2-ethylhexoxy)propane-1,2-diol.
| Compound Name | ethoxyethane;3-(2-ethylhexoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 87069112 |
| Molecular Formula | C15H34O4 |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | ethoxyethane;3-(2-ethylhexoxy)propane-1,2-diol |
| SMILES | CCCCC(CC)COCC(O)CO.CCOCC |
| InChI | InChI=1S/C11H24O3.C4H10O/c1-3-5-6-10(4-2)8-14-9-11(13)7-12;1-3-5-4-2/h10-13H,3-9H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | XRKQMJZXNHPADX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |