About CID 88753128
CID 88753128 (PubChem CID 88753128) has the molecular formula C19H40NaO3
and a molecular weight of 339.52 g/mol.
Molecular Properties
| Compound Name | CID 88753128 |
| PubChem CID | 88753128 |
| Molecular Formula | C19H40NaO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COCC(O)COCC(CC)CCCC.[Na] |
| InChI | InChI=1S/C19H40O3.Na/c1-5-9-11-17(7-3)13-21-15-19(20)16-22-14-18(8-4)12-10-6-2;/h17-20H,5-16H2,1-4H3; |
| InChIKey | KZWXNEIQJVLSIY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 88753128 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88753128?
The IUPAC name of CID 88753128 (CID 88753128) is not available.
What is the SMILES notation for CID 88753128?
The canonical SMILES for CID 88753128 is CCCCC(CC)COCC(O)COCC(CC)CCCC.[Na].
What is the InChIKey of CID 88753128?
The InChIKey is KZWXNEIQJVLSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O3.Na/c1-5-9-11-17(7-3)13-21-15-19(20)16-22-14-18(8-4)12-10-6-2;/h17-20H,5-16H2,1-4H3;.
What are the key properties of CID 88753128?
CID 88753128 has a molecular weight of 339.52 g/mol, XLogP of 4.43, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88753128 is sourced from PubChem (CID 88753128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).