C20H42O4 — CID 11057128
(2R)-3-[(2S)-2-methoxyhexadecoxy]propane-1,2-diol (PubChem CID 11057128) has the molecular formula C20H42O4 and a molecular weight of 346.55 g/mol. Its IUPAC name is (2R)-3-[(2S)-2-methoxyhexadecoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(2S)-2-methoxyhexadecoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 11057128 |
| Molecular Formula | C20H42O4 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | (2R)-3-[(2S)-2-methoxyhexadecoxy]propane-1,2-diol |
| SMILES | CCCCCCCCCCCCCC[C@@H](COC[C@H](O)CO)OC |
| InChI | InChI=1S/C20H42O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20(23-2)18-24-17-19(22)16-21/h19-22H,3-18H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | LMVRXHKEYGPTCX-UXHICEINSA-N |
| XLogP | 4.46 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|