C17H36O4 — CID 137323862
(2S)-3-[(2R)-2-hydroxytetradecoxy]propane-1,2-diol (PubChem CID 137323862) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S)-3-[(2R)-2-hydroxytetradecoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R)-2-hydroxytetradecoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 137323862 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | (2S)-3-[(2R)-2-hydroxytetradecoxy]propane-1,2-diol |
| SMILES | CCCCCCCCCCCC[C@@H](O)COC[C@@H](O)CO |
| InChI | InChI=1S/C17H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-16(19)14-21-15-17(20)13-18/h16-20H,2-15H2,1H3/t16-,17+/m1/s1 |
| InChIKey | NWPUZHCKNYVMOZ-SJORKVTESA-N |
| XLogP | 3.03 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|