C42H90O6 — CID 174724990
3-(2,3-dihydroxypropoxy)propane-1,2-diol;hexadecane;icosan-9-ol (PubChem CID 174724990) has the molecular formula C42H90O6 and a molecular weight of 691.18 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)propane-1,2-diol;hexadecane;icosan-9-ol.
| Compound Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;hexadecane;icosan-9-ol |
|---|---|
| PubChem CID | 174724990 |
| Molecular Formula | C42H90O6 |
| Molecular Weight | 691.18 g/mol |
| Exact Mass | 690.67 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;hexadecane;icosan-9-ol |
| SMILES | CCCCCCCCCCCC(O)CCCCCCCC.CCCCCCCCCCCCCCCC.OCC(O)COCC(O)CO |
| InChI | InChI=1S/C20H42O.C16H34.C6H14O5/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2;1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;7-1-5(9)3-11-4-6(10)2-8/h20-21H,3-19H2,1-2H3;3-16H2,1-2H3;5-10H,1-4H2 |
| InChIKey | OFCXJCNKVHAFAO-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.18 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|