About bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin
bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin (PubChem CID 87392614) has the molecular formula C41H88O2Sn
and a molecular weight of 731.86 g/mol. Its IUPAC name is bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin.
Molecular Properties
| Compound Name | bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin |
| PubChem CID | 87392614 |
| Molecular Formula | C41H88O2Sn |
| Molecular Weight | 731.86 g/mol |
| Exact Mass | 732.58 |
| IUPAC Name | bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin |
| SMILES | CCCCC(CC)COCC(CC)CCCC.CCCCC(CC)COCC(CC)CCCC.CCCCC(CC)C[Sn]C |
| InChI | InChI=1S/2C16H34O.C8H17.CH3.Sn/c2*1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-4-6-7-8(3)5-2;;/h2*15-16H,5-14H2,1-4H3;8H,3-7H2,1-2H3;1H3; |
| InChIKey | OTIUFLUNGPXVGV-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 731.86 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin?
The IUPAC name of bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin (CID 87392614) is bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin.
What is the SMILES notation for bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin?
The canonical SMILES for bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin is CCCCC(CC)COCC(CC)CCCC.CCCCC(CC)COCC(CC)CCCC.CCCCC(CC)C[Sn]C.
What is the InChIKey of bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin?
The InChIKey is OTIUFLUNGPXVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H34O.C8H17.CH3.Sn/c2*1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-4-6-7-8(3)5-2;;/h2*15-16H,5-14H2,1-4H3;8H,3-7H2,1-2H3;1H3;.
What are the key properties of bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin?
bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin has a molecular weight of 731.86 g/mol, XLogP of 14.24, 30 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-(2-ethylhexoxymethyl)heptane);2-ethylhexyl(methyl)tin is sourced from PubChem (CID 87392614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).