About butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)
butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) (PubChem CID 87243142) has the molecular formula C16H27AlO7
and a molecular weight of 358.37 g/mol. Its IUPAC name is butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate).
Molecular Properties
| Compound Name | butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) |
| PubChem CID | 87243142 |
| Molecular Formula | C16H27AlO7 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) |
| SMILES | CCC(C(C)=O)C(=O)[O-].CCC(C(C)=O)C(=O)[O-].CCCCO[Al+2] |
| InChI | InChI=1S/2C6H10O3.C4H9O.Al/c2*1-3-5(4(2)7)6(8)9;1-2-3-4-5;/h2*5H,3H2,1-2H3,(H,8,9);2-4H2,1H3;/q;;-1;+3/p-2 |
| InChIKey | ZYFMISZDVAYGOW-UHFFFAOYSA-L |
| XLogP | -0.41 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The IUPAC name of butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) (CID 87243142) is butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate).
What is the SMILES notation for butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The canonical SMILES for butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) is CCC(C(C)=O)C(=O)[O-].CCC(C(C)=O)C(=O)[O-].CCCCO[Al+2].
What is the InChIKey of butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
The InChIKey is ZYFMISZDVAYGOW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H10O3.C4H9O.Al/c2*1-3-5(4(2)7)6(8)9;1-2-3-4-5;/h2*5H,3H2,1-2H3,(H,8,9);2-4H2,1H3;/q;;-1;+3/p-2.
What are the key properties of butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate)?
butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) has a molecular weight of 358.37 g/mol, XLogP of -0.41, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butoxyaluminum(2+);bis(2-ethyl-3-oxobutanoate) is sourced from PubChem (CID 87243142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).