About aluminum;2-ethyl-3-oxobutanoate;dihydroxide
aluminum;2-ethyl-3-oxobutanoate;dihydroxide (PubChem CID 174056917) has the molecular formula C6H11AlO5
and a molecular weight of 190.13 g/mol. Its IUPAC name is aluminum;2-ethyl-3-oxobutanoate;dihydroxide.
Molecular Properties
| Compound Name | aluminum;2-ethyl-3-oxobutanoate;dihydroxide |
| PubChem CID | 174056917 |
| Molecular Formula | C6H11AlO5 |
| Molecular Weight | 190.13 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | aluminum;2-ethyl-3-oxobutanoate;dihydroxide |
| SMILES | CCC(C(C)=O)C(=O)[O-].[Al+3].[OH-].[OH-] |
| InChI | InChI=1S/C6H10O3.Al.2H2O/c1-3-5(4(2)7)6(8)9;;;/h5H,3H2,1-2H3,(H,8,9);;2*1H2/q;+3;;/p-3 |
| InChIKey | YILMQTBDRCOPJE-UHFFFAOYSA-K |
| XLogP | -1.38 |
| TPSA | 117.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.13 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze aluminum;2-ethyl-3-oxobutanoate;dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;2-ethyl-3-oxobutanoate;dihydroxide?
The IUPAC name of aluminum;2-ethyl-3-oxobutanoate;dihydroxide (CID 174056917) is aluminum;2-ethyl-3-oxobutanoate;dihydroxide.
What is the SMILES notation for aluminum;2-ethyl-3-oxobutanoate;dihydroxide?
The canonical SMILES for aluminum;2-ethyl-3-oxobutanoate;dihydroxide is CCC(C(C)=O)C(=O)[O-].[Al+3].[OH-].[OH-].
What is the InChIKey of aluminum;2-ethyl-3-oxobutanoate;dihydroxide?
The InChIKey is YILMQTBDRCOPJE-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H10O3.Al.2H2O/c1-3-5(4(2)7)6(8)9;;;/h5H,3H2,1-2H3,(H,8,9);;2*1H2/q;+3;;/p-3.
What are the key properties of aluminum;2-ethyl-3-oxobutanoate;dihydroxide?
aluminum;2-ethyl-3-oxobutanoate;dihydroxide has a molecular weight of 190.13 g/mol, XLogP of -1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;2-ethyl-3-oxobutanoate;dihydroxide is sourced from PubChem (CID 174056917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).