About magnesium;butane;propanedioate
magnesium;butane;propanedioate (PubChem CID 18427664) has the molecular formula C7H12MgO4
and a molecular weight of 184.47 g/mol. Its IUPAC name is magnesium;butane;propanedioate.
Molecular Properties
| Compound Name | magnesium;butane;propanedioate |
| PubChem CID | 18427664 |
| Molecular Formula | C7H12MgO4 |
| Molecular Weight | 184.47 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | magnesium;butane;propanedioate |
| SMILES | CCCC.O=C([O-])CC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C4H10.C3H4O4.Mg/c1-3-4-2;4-2(5)1-3(6)7;/h3-4H2,1-2H3;1H2,(H,4,5)(H,6,7);/q;;+2/p-2 |
| InChIKey | OOUBGQGIRYSYMN-UHFFFAOYSA-L |
| XLogP | -1.70 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.47 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze magnesium;butane;propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butane;propanedioate?
The IUPAC name of magnesium;butane;propanedioate (CID 18427664) is magnesium;butane;propanedioate.
What is the SMILES notation for magnesium;butane;propanedioate?
The canonical SMILES for magnesium;butane;propanedioate is CCCC.O=C([O-])CC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium;butane;propanedioate?
The InChIKey is OOUBGQGIRYSYMN-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10.C3H4O4.Mg/c1-3-4-2;4-2(5)1-3(6)7;/h3-4H2,1-2H3;1H2,(H,4,5)(H,6,7);/q;;+2/p-2.
What are the key properties of magnesium;butane;propanedioate?
magnesium;butane;propanedioate has a molecular weight of 184.47 g/mol, XLogP of -1.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butane;propanedioate is sourced from PubChem (CID 18427664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).