About tetraazanium;ethanolate;propanedioate
tetraazanium;ethanolate;propanedioate (PubChem CID 141132679) has the molecular formula C7H28N4O6
and a molecular weight of 264.32 g/mol. Its IUPAC name is tetraazanium;ethanolate;propanedioate.
Molecular Properties
| Compound Name | tetraazanium;ethanolate;propanedioate |
| PubChem CID | 141132679 |
| Molecular Formula | C7H28N4O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | tetraazanium;ethanolate;propanedioate |
| SMILES | CC[O-].CC[O-].O=C([O-])CC(=O)[O-].[NH4+].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H4O4.2C2H5O.4H3N/c4-2(5)1-3(6)7;2*1-2-3;;;;/h1H2,(H,4,5)(H,6,7);2*2H2,1H3;4*1H3/q;2*-1;;;;/p+2 |
| InChIKey | ZTVRDJYMBMMSRH-UHFFFAOYSA-P |
| XLogP | -2.89 |
| TPSA | 272.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tetraazanium;ethanolate;propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraazanium;ethanolate;propanedioate?
The IUPAC name of tetraazanium;ethanolate;propanedioate (CID 141132679) is tetraazanium;ethanolate;propanedioate.
What is the SMILES notation for tetraazanium;ethanolate;propanedioate?
The canonical SMILES for tetraazanium;ethanolate;propanedioate is CC[O-].CC[O-].O=C([O-])CC(=O)[O-].[NH4+].[NH4+].[NH4+].[NH4+].
What is the InChIKey of tetraazanium;ethanolate;propanedioate?
The InChIKey is ZTVRDJYMBMMSRH-UHFFFAOYSA-P. The full InChI is InChI=1S/C3H4O4.2C2H5O.4H3N/c4-2(5)1-3(6)7;2*1-2-3;;;;/h1H2,(H,4,5)(H,6,7);2*2H2,1H3;4*1H3/q;2*-1;;;;/p+2.
What are the key properties of tetraazanium;ethanolate;propanedioate?
tetraazanium;ethanolate;propanedioate has a molecular weight of 264.32 g/mol, XLogP of -2.89, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tetraazanium;ethanolate;propanedioate is sourced from PubChem (CID 141132679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).