About triazanium;butanoate;ethanolate
triazanium;butanoate;ethanolate (PubChem CID 141132655) has the molecular formula C8H29N3O4
and a molecular weight of 231.34 g/mol. Its IUPAC name is triazanium;butanoate;ethanolate.
Molecular Properties
| Compound Name | triazanium;butanoate;ethanolate |
| PubChem CID | 141132655 |
| Molecular Formula | C8H29N3O4 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | triazanium;butanoate;ethanolate |
| SMILES | CCCC(=O)[O-].CC[O-].CC[O-].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H8O2.2C2H5O.3H3N/c1-2-3-4(5)6;2*1-2-3;;;/h2-3H2,1H3,(H,5,6);2*2H2,1H3;3*1H3/q;2*-1;;;/p+2 |
| InChIKey | FOINSINGCAXFJI-UHFFFAOYSA-P |
| XLogP | -0.60 |
| TPSA | 195.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze triazanium;butanoate;ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazanium;butanoate;ethanolate?
The IUPAC name of triazanium;butanoate;ethanolate (CID 141132655) is triazanium;butanoate;ethanolate.
What is the SMILES notation for triazanium;butanoate;ethanolate?
The canonical SMILES for triazanium;butanoate;ethanolate is CCCC(=O)[O-].CC[O-].CC[O-].[NH4+].[NH4+].[NH4+].
What is the InChIKey of triazanium;butanoate;ethanolate?
The InChIKey is FOINSINGCAXFJI-UHFFFAOYSA-P. The full InChI is InChI=1S/C4H8O2.2C2H5O.3H3N/c1-2-3-4(5)6;2*1-2-3;;;/h2-3H2,1H3,(H,5,6);2*2H2,1H3;3*1H3/q;2*-1;;;/p+2.
What are the key properties of triazanium;butanoate;ethanolate?
triazanium;butanoate;ethanolate has a molecular weight of 231.34 g/mol, XLogP of -0.60, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triazanium;butanoate;ethanolate is sourced from PubChem (CID 141132655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).