About copper;propanedioate;hydrate
copper;propanedioate;hydrate (PubChem CID 155143676) has the molecular formula C3H4CuO5
and a molecular weight of 183.61 g/mol. Its IUPAC name is copper;propanedioate;hydrate.
Molecular Properties
| Compound Name | copper;propanedioate;hydrate |
| PubChem CID | 155143676 |
| Molecular Formula | C3H4CuO5 |
| Molecular Weight | 183.61 g/mol |
| Exact Mass | 182.94 |
| IUPAC Name | copper;propanedioate;hydrate |
| SMILES | O.O=C([O-])CC(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C3H4O4.Cu.H2O/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;1H2/q;+2;/p-2 |
| InChIKey | JDFLXSJYBIVNBQ-UHFFFAOYSA-L |
| XLogP | -3.95 |
| TPSA | 111.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.61 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze copper;propanedioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;propanedioate;hydrate?
The IUPAC name of copper;propanedioate;hydrate (CID 155143676) is copper;propanedioate;hydrate.
What is the SMILES notation for copper;propanedioate;hydrate?
The canonical SMILES for copper;propanedioate;hydrate is O.O=C([O-])CC(=O)[O-].[Cu+2].
What is the InChIKey of copper;propanedioate;hydrate?
The InChIKey is JDFLXSJYBIVNBQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O4.Cu.H2O/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;1H2/q;+2;/p-2.
What are the key properties of copper;propanedioate;hydrate?
copper;propanedioate;hydrate has a molecular weight of 183.61 g/mol, XLogP of -3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;propanedioate;hydrate is sourced from PubChem (CID 155143676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).