About diazanium;2-methylidenebutanedioate;hydrate
diazanium;2-methylidenebutanedioate;hydrate (PubChem CID 141442888) has the molecular formula C5H14N2O5
and a molecular weight of 182.18 g/mol. Its IUPAC name is diazanium;2-methylidenebutanedioate;hydrate.
Molecular Properties
| Compound Name | diazanium;2-methylidenebutanedioate;hydrate |
| PubChem CID | 141442888 |
| Molecular Formula | C5H14N2O5 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | diazanium;2-methylidenebutanedioate;hydrate |
| SMILES | C=C(CC(=O)[O-])C(=O)[O-].O.[NH4+].[NH4+] |
| InChI | InChI=1S/C5H6O4.2H3N.H2O/c1-3(5(8)9)2-4(6)7;;;/h1-2H2,(H,6,7)(H,8,9);2*1H3;1H2 |
| InChIKey | WJLPKTQSPJYSMF-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;2-methylidenebutanedioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-methylidenebutanedioate;hydrate?
The IUPAC name of diazanium;2-methylidenebutanedioate;hydrate (CID 141442888) is diazanium;2-methylidenebutanedioate;hydrate.
What is the SMILES notation for diazanium;2-methylidenebutanedioate;hydrate?
The canonical SMILES for diazanium;2-methylidenebutanedioate;hydrate is C=C(CC(=O)[O-])C(=O)[O-].O.[NH4+].[NH4+].
What is the InChIKey of diazanium;2-methylidenebutanedioate;hydrate?
The InChIKey is WJLPKTQSPJYSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.2H3N.H2O/c1-3(5(8)9)2-4(6)7;;;/h1-2H2,(H,6,7)(H,8,9);2*1H3;1H2.
What are the key properties of diazanium;2-methylidenebutanedioate;hydrate?
diazanium;2-methylidenebutanedioate;hydrate has a molecular weight of 182.18 g/mol, XLogP of -2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-methylidenebutanedioate;hydrate is sourced from PubChem (CID 141442888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).