About disodium;2-methylidenebutanedioate;methyl prop-2-enoate
disodium;2-methylidenebutanedioate;methyl prop-2-enoate (PubChem CID 172852156) has the molecular formula C9H10Na2O6
and a molecular weight of 260.15 g/mol. Its IUPAC name is disodium;2-methylidenebutanedioate;methyl prop-2-enoate.
Molecular Properties
| Compound Name | disodium;2-methylidenebutanedioate;methyl prop-2-enoate |
| PubChem CID | 172852156 |
| Molecular Formula | C9H10Na2O6 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | disodium;2-methylidenebutanedioate;methyl prop-2-enoate |
| SMILES | C=C(CC(=O)[O-])C(=O)[O-].C=CC(=O)OC.[Na+].[Na+] |
| InChI | InChI=1S/C5H6O4.C4H6O2.2Na/c1-3(5(8)9)2-4(6)7;1-3-4(5)6-2;;/h1-2H2,(H,6,7)(H,8,9);3H,1H2,2H3;;/q;;2*+1/p-2 |
| InChIKey | YFEOFMRXTSQNIH-UHFFFAOYSA-L |
| XLogP | -8.21 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | -8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-methylidenebutanedioate;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-methylidenebutanedioate;methyl prop-2-enoate?
The IUPAC name of disodium;2-methylidenebutanedioate;methyl prop-2-enoate (CID 172852156) is disodium;2-methylidenebutanedioate;methyl prop-2-enoate.
What is the SMILES notation for disodium;2-methylidenebutanedioate;methyl prop-2-enoate?
The canonical SMILES for disodium;2-methylidenebutanedioate;methyl prop-2-enoate is C=C(CC(=O)[O-])C(=O)[O-].C=CC(=O)OC.[Na+].[Na+].
What is the InChIKey of disodium;2-methylidenebutanedioate;methyl prop-2-enoate?
The InChIKey is YFEOFMRXTSQNIH-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H6O4.C4H6O2.2Na/c1-3(5(8)9)2-4(6)7;1-3-4(5)6-2;;/h1-2H2,(H,6,7)(H,8,9);3H,1H2,2H3;;/q;;2*+1/p-2.
What are the key properties of disodium;2-methylidenebutanedioate;methyl prop-2-enoate?
disodium;2-methylidenebutanedioate;methyl prop-2-enoate has a molecular weight of 260.15 g/mol, XLogP of -8.21, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-methylidenebutanedioate;methyl prop-2-enoate is sourced from PubChem (CID 172852156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).