About dimethoxymethane;methyl prop-2-enoate
dimethoxymethane;methyl prop-2-enoate (PubChem CID 162245850) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is dimethoxymethane;methyl prop-2-enoate.
Molecular Properties
| Compound Name | dimethoxymethane;methyl prop-2-enoate |
| PubChem CID | 162245850 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | dimethoxymethane;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.COCOC |
| InChI | InChI=1S/C4H6O2.C3H8O2/c1-3-4(5)6-2;1-4-3-5-2/h3H,1H2,2H3;3H2,1-2H3 |
| InChIKey | ZXHYVVUYGBHQTP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethoxymethane;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxymethane;methyl prop-2-enoate?
The IUPAC name of dimethoxymethane;methyl prop-2-enoate (CID 162245850) is dimethoxymethane;methyl prop-2-enoate.
What is the SMILES notation for dimethoxymethane;methyl prop-2-enoate?
The canonical SMILES for dimethoxymethane;methyl prop-2-enoate is C=CC(=O)OC.COCOC.
What is the InChIKey of dimethoxymethane;methyl prop-2-enoate?
The InChIKey is ZXHYVVUYGBHQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H8O2/c1-3-4(5)6-2;1-4-3-5-2/h3H,1H2,2H3;3H2,1-2H3.
What are the key properties of dimethoxymethane;methyl prop-2-enoate?
dimethoxymethane;methyl prop-2-enoate has a molecular weight of 162.19 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxymethane;methyl prop-2-enoate is sourced from PubChem (CID 162245850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).