About 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium)
2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) (PubChem CID 88714703) has the molecular formula C23H48N2O4
and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium).
Molecular Properties
| Compound Name | 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) |
| PubChem CID | 88714703 |
| Molecular Formula | C23H48N2O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) |
| SMILES | C=C(CC(=O)[O-])C(=O)[O-].CC[N+](CC)(CC)C(C)C.CC[N+](CC)(CC)C(C)C |
| InChI | InChI=1S/2C9H22N.C5H6O4/c2*1-6-10(7-2,8-3)9(4)5;1-3(5(8)9)2-4(6)7/h2*9H,6-8H2,1-5H3;1-2H2,(H,6,7)(H,8,9)/q2*+1;/p-2 |
| InChIKey | RIRYPNPHPDIOTM-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium)?
The IUPAC name of 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) (CID 88714703) is 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium).
What is the SMILES notation for 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium)?
The canonical SMILES for 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) is C=C(CC(=O)[O-])C(=O)[O-].CC[N+](CC)(CC)C(C)C.CC[N+](CC)(CC)C(C)C.
What is the InChIKey of 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium)?
The InChIKey is RIRYPNPHPDIOTM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H22N.C5H6O4/c2*1-6-10(7-2,8-3)9(4)5;1-3(5(8)9)2-4(6)7/h2*9H,6-8H2,1-5H3;1-2H2,(H,6,7)(H,8,9)/q2*+1;/p-2.
What are the key properties of 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium)?
2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) has a molecular weight of 416.65 g/mol, XLogP of 1.98, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanedioate;bis(triethyl(propan-2-yl)azanium) is sourced from PubChem (CID 88714703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).