About N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium)
N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) (PubChem CID 174679005) has the molecular formula C22H48N4O4
and a molecular weight of 432.65 g/mol. Its IUPAC name is N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium).
Molecular Properties
| Compound Name | N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) |
| PubChem CID | 174679005 |
| Molecular Formula | C22H48N4O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.37 |
| IUPAC Name | N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) |
| SMILES | CC[N+](CC)(C(C)C)C(C)C.CC[N+](CC)(C(C)C)C(C)C.O=C([O-])N=NC(=O)[O-] |
| InChI | InChI=1S/2C10H24N.C2H2N2O4/c2*1-7-11(8-2,9(3)4)10(5)6;5-1(6)3-4-2(7)8/h2*9-10H,7-8H2,1-6H3;(H,5,6)(H,7,8)/q2*+1;/p-2 |
| InChIKey | ZITMQXHHOZWODA-UHFFFAOYSA-L |
| XLogP | 3.44 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium)?
The IUPAC name of N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) (CID 174679005) is N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium).
What is the SMILES notation for N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium)?
The canonical SMILES for N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) is CC[N+](CC)(C(C)C)C(C)C.CC[N+](CC)(C(C)C)C(C)C.O=C([O-])N=NC(=O)[O-].
What is the InChIKey of N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium)?
The InChIKey is ZITMQXHHOZWODA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H24N.C2H2N2O4/c2*1-7-11(8-2,9(3)4)10(5)6;5-1(6)3-4-2(7)8/h2*9-10H,7-8H2,1-6H3;(H,5,6)(H,7,8)/q2*+1;/p-2.
What are the key properties of N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium)?
N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) has a molecular weight of 432.65 g/mol, XLogP of 3.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-carboxylatoiminocarbamate;bis(diethyl-di(propan-2-yl)azanium) is sourced from PubChem (CID 174679005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).