About 2-methylidenebutanoate;trimethylazanium;chloride
2-methylidenebutanoate;trimethylazanium;chloride (PubChem CID 23504332) has the molecular formula C8H17ClNO2-
and a molecular weight of 194.68 g/mol. Its IUPAC name is 2-methylidenebutanoate;trimethylazanium;chloride.
Molecular Properties
| Compound Name | 2-methylidenebutanoate;trimethylazanium;chloride |
| PubChem CID | 23504332 |
| Molecular Formula | C8H17ClNO2- |
| Molecular Weight | 194.68 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-methylidenebutanoate;trimethylazanium;chloride |
| SMILES | C=C(CC)C(=O)[O-].C[NH+](C)C.[Cl-] |
| InChI | InChI=1S/C5H8O2.C3H9N.ClH/c1-3-4(2)5(6)7;1-4(2)3;/h2-3H2,1H3,(H,6,7);1-3H3;1H/p-1 |
| InChIKey | NILRHFGKHYOOQL-UHFFFAOYSA-M |
| XLogP | -4.53 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.68 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanoate;trimethylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanoate;trimethylazanium;chloride?
The IUPAC name of 2-methylidenebutanoate;trimethylazanium;chloride (CID 23504332) is 2-methylidenebutanoate;trimethylazanium;chloride.
What is the SMILES notation for 2-methylidenebutanoate;trimethylazanium;chloride?
The canonical SMILES for 2-methylidenebutanoate;trimethylazanium;chloride is C=C(CC)C(=O)[O-].C[NH+](C)C.[Cl-].
What is the InChIKey of 2-methylidenebutanoate;trimethylazanium;chloride?
The InChIKey is NILRHFGKHYOOQL-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O2.C3H9N.ClH/c1-3-4(2)5(6)7;1-4(2)3;/h2-3H2,1H3,(H,6,7);1-3H3;1H/p-1.
What are the key properties of 2-methylidenebutanoate;trimethylazanium;chloride?
2-methylidenebutanoate;trimethylazanium;chloride has a molecular weight of 194.68 g/mol, XLogP of -4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanoate;trimethylazanium;chloride is sourced from PubChem (CID 23504332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).