About 2-methylidenebutanamide;trimethylazanium;bromide
2-methylidenebutanamide;trimethylazanium;bromide (PubChem CID 87506814) has the molecular formula C8H19BrN2O
and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-methylidenebutanamide;trimethylazanium;bromide.
Molecular Properties
| Compound Name | 2-methylidenebutanamide;trimethylazanium;bromide |
| PubChem CID | 87506814 |
| Molecular Formula | C8H19BrN2O |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-methylidenebutanamide;trimethylazanium;bromide |
| SMILES | C=C(CC)C(N)=O.C[NH+](C)C.[Br-] |
| InChI | InChI=1S/C5H9NO.C3H9N.BrH/c1-3-4(2)5(6)7;1-4(2)3;/h2-3H2,1H3,(H2,6,7);1-3H3;1H |
| InChIKey | GINNCLJSCXFULI-UHFFFAOYSA-N |
| XLogP | -3.80 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanamide;trimethylazanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanamide;trimethylazanium;bromide?
The IUPAC name of 2-methylidenebutanamide;trimethylazanium;bromide (CID 87506814) is 2-methylidenebutanamide;trimethylazanium;bromide.
What is the SMILES notation for 2-methylidenebutanamide;trimethylazanium;bromide?
The canonical SMILES for 2-methylidenebutanamide;trimethylazanium;bromide is C=C(CC)C(N)=O.C[NH+](C)C.[Br-].
What is the InChIKey of 2-methylidenebutanamide;trimethylazanium;bromide?
The InChIKey is GINNCLJSCXFULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H9N.BrH/c1-3-4(2)5(6)7;1-4(2)3;/h2-3H2,1H3,(H2,6,7);1-3H3;1H.
What are the key properties of 2-methylidenebutanamide;trimethylazanium;bromide?
2-methylidenebutanamide;trimethylazanium;bromide has a molecular weight of 239.16 g/mol, XLogP of -3.80, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanamide;trimethylazanium;bromide is sourced from PubChem (CID 87506814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).