C8H18N2O — CID 87072562
N,N-dimethylmethanamine;2-methylidenebutanamide (PubChem CID 87072562) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-methylidenebutanamide.
| Compound Name | N,N-dimethylmethanamine;2-methylidenebutanamide |
|---|---|
| PubChem CID | 87072562 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N,N-dimethylmethanamine;2-methylidenebutanamide |
| SMILES | C=C(CC)C(N)=O.CN(C)C |
| InChI | InChI=1S/C5H9NO.C3H9N/c1-3-4(2)5(6)7;1-4(2)3/h2-3H2,1H3,(H2,6,7);1-3H3 |
| InChIKey | DKGRBBLAWGWSDS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|