C8H19N — CID 88812091
N,N-dimethylmethanamine;2-methylbut-1-ene (PubChem CID 88812091) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-methylbut-1-ene.
| Compound Name | N,N-dimethylmethanamine;2-methylbut-1-ene |
|---|---|
| PubChem CID | 88812091 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,N-dimethylmethanamine;2-methylbut-1-ene |
| SMILES | C=C(C)CC.CN(C)C |
| InChI | InChI=1S/C5H10.C3H9N/c1-4-5(2)3;1-4(2)3/h2,4H2,1,3H3;1-3H3 |
| InChIKey | WUXSIVALVCZMQG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|