About N,N-dimethylmethanamine;2-methylbut-1-ene
N,N-dimethylmethanamine;2-methylbut-1-ene (PubChem CID 88812091) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-methylbut-1-ene.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;2-methylbut-1-ene |
| PubChem CID | 88812091 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,N-dimethylmethanamine;2-methylbut-1-ene |
| SMILES | C=C(C)CC.CN(C)C |
| InChI | InChI=1S/C5H10.C3H9N/c1-4-5(2)3;1-4(2)3/h2,4H2,1,3H3;1-3H3 |
| InChIKey | WUXSIVALVCZMQG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;2-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;2-methylbut-1-ene?
The IUPAC name of N,N-dimethylmethanamine;2-methylbut-1-ene (CID 88812091) is N,N-dimethylmethanamine;2-methylbut-1-ene.
What is the SMILES notation for N,N-dimethylmethanamine;2-methylbut-1-ene?
The canonical SMILES for N,N-dimethylmethanamine;2-methylbut-1-ene is C=C(C)CC.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;2-methylbut-1-ene?
The InChIKey is WUXSIVALVCZMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.C3H9N/c1-4-5(2)3;1-4(2)3/h2,4H2,1,3H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;2-methylbut-1-ene?
N,N-dimethylmethanamine;2-methylbut-1-ene has a molecular weight of 129.25 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;2-methylbut-1-ene is sourced from PubChem (CID 88812091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).