C5H4O8P-5 — CID 19373893
2-methylidenebutanedioate phosphate (PubChem CID 19373893) has the molecular formula C5H4O8P-5 and a molecular weight of 223.05 g/mol. Its IUPAC name is 2-methylidenebutanedioate phosphate.
| Compound Name | 2-methylidenebutanedioate phosphate |
|---|---|
| PubChem CID | 19373893 |
| Molecular Formula | C5H4O8P-5 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2-methylidenebutanedioate phosphate |
| SMILES | C=C(CC(=O)[O-])C(=O)[O-].O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C5H6O4.H3O4P/c1-3(5(8)9)2-4(6)7;1-5(2,3)4/h1-2H2,(H,6,7)(H,8,9);(H3,1,2,3,4)/p-5 |
| InChIKey | XLLSSWXDJWPSSW-UHFFFAOYSA-I |
| XLogP | -5.39 |
| TPSA | 166.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|