About magnesium;carbonate;phosphate
magnesium;carbonate;phosphate (PubChem CID 19104532) has the molecular formula CMgO7P-3
and a molecular weight of 179.28 g/mol. Its IUPAC name is magnesium;carbonate;phosphate.
Molecular Properties
| Compound Name | magnesium;carbonate;phosphate |
| PubChem CID | 19104532 |
| Molecular Formula | CMgO7P-3 |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 178.92 |
| IUPAC Name | magnesium;carbonate;phosphate |
| SMILES | O=C([O-])[O-].O=P([O-])([O-])[O-].[Mg+2] |
| InChI | InChI=1S/CH2O3.Mg.H3O4P/c2-1(3)4;;1-5(2,3)4/h(H2,2,3,4);;(H3,1,2,3,4)/q;+2;/p-5 |
| InChIKey | HWNAPRLLHZGLCM-UHFFFAOYSA-I |
| XLogP | -5.65 |
| TPSA | 149.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium;carbonate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;carbonate;phosphate?
The IUPAC name of magnesium;carbonate;phosphate (CID 19104532) is magnesium;carbonate;phosphate.
What is the SMILES notation for magnesium;carbonate;phosphate?
The canonical SMILES for magnesium;carbonate;phosphate is O=C([O-])[O-].O=P([O-])([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;carbonate;phosphate?
The InChIKey is HWNAPRLLHZGLCM-UHFFFAOYSA-I. The full InChI is InChI=1S/CH2O3.Mg.H3O4P/c2-1(3)4;;1-5(2,3)4/h(H2,2,3,4);;(H3,1,2,3,4)/q;+2;/p-5.
What are the key properties of magnesium;carbonate;phosphate?
magnesium;carbonate;phosphate has a molecular weight of 179.28 g/mol, XLogP of -5.65, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;carbonate;phosphate is sourced from PubChem (CID 19104532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).