About pentapotassium;carbonate;phosphate
pentapotassium;carbonate;phosphate (PubChem CID 173178340) has the molecular formula CK5O7P
and a molecular weight of 350.47 g/mol. Its IUPAC name is pentapotassium;carbonate;phosphate.
Molecular Properties
| Compound Name | pentapotassium;carbonate;phosphate |
| PubChem CID | 173178340 |
| Molecular Formula | CK5O7P |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 349.76 |
| IUPAC Name | pentapotassium;carbonate;phosphate |
| SMILES | O=C([O-])[O-].O=P([O-])([O-])[O-].[K+].[K+].[K+].[K+].[K+] |
| InChI | InChI=1S/CH2O3.5K.H3O4P/c2-1(3)4;;;;;;1-5(2,3)4/h(H2,2,3,4);;;;;;(H3,1,2,3,4)/q;5*+1;/p-5 |
| InChIKey | IGMGZXYCEGTELE-UHFFFAOYSA-I |
| XLogP | -20.25 |
| TPSA | 149.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | -20.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentapotassium;carbonate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentapotassium;carbonate;phosphate?
The IUPAC name of pentapotassium;carbonate;phosphate (CID 173178340) is pentapotassium;carbonate;phosphate.
What is the SMILES notation for pentapotassium;carbonate;phosphate?
The canonical SMILES for pentapotassium;carbonate;phosphate is O=C([O-])[O-].O=P([O-])([O-])[O-].[K+].[K+].[K+].[K+].[K+].
What is the InChIKey of pentapotassium;carbonate;phosphate?
The InChIKey is IGMGZXYCEGTELE-UHFFFAOYSA-I. The full InChI is InChI=1S/CH2O3.5K.H3O4P/c2-1(3)4;;;;;;1-5(2,3)4/h(H2,2,3,4);;;;;;(H3,1,2,3,4)/q;5*+1;/p-5.
What are the key properties of pentapotassium;carbonate;phosphate?
pentapotassium;carbonate;phosphate has a molecular weight of 350.47 g/mol, XLogP of -20.25, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pentapotassium;carbonate;phosphate is sourced from PubChem (CID 173178340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).