About hydroxymethylphosphanium;acetate;phosphate
hydroxymethylphosphanium;acetate;phosphate (PubChem CID 163479536) has the molecular formula C6H27O10P5
and a molecular weight of 414.14 g/mol. Its IUPAC name is hydroxymethylphosphanium;acetate;phosphate.
Molecular Properties
| Compound Name | hydroxymethylphosphanium;acetate;phosphate |
| PubChem CID | 163479536 |
| Molecular Formula | C6H27O10P5 |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | hydroxymethylphosphanium;acetate;phosphate |
| SMILES | CC(=O)[O-].O=P([O-])([O-])[O-].OC[PH3+].OC[PH3+].OC[PH3+].OC[PH3+] |
| InChI | InChI=1S/C2H4O2.4CH5OP.H3O4P/c1-2(3)4;4*2-1-3;1-5(2,3)4/h1H3,(H,3,4);4*2H,1,3H2;(H3,1,2,3,4) |
| InChIKey | CDIHNQOOGNMTBR-UHFFFAOYSA-N |
| XLogP | -5.89 |
| TPSA | 207.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethylphosphanium;acetate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethylphosphanium;acetate;phosphate?
The IUPAC name of hydroxymethylphosphanium;acetate;phosphate (CID 163479536) is hydroxymethylphosphanium;acetate;phosphate.
What is the SMILES notation for hydroxymethylphosphanium;acetate;phosphate?
The canonical SMILES for hydroxymethylphosphanium;acetate;phosphate is CC(=O)[O-].O=P([O-])([O-])[O-].OC[PH3+].OC[PH3+].OC[PH3+].OC[PH3+].
What is the InChIKey of hydroxymethylphosphanium;acetate;phosphate?
The InChIKey is CDIHNQOOGNMTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.4CH5OP.H3O4P/c1-2(3)4;4*2-1-3;1-5(2,3)4/h1H3,(H,3,4);4*2H,1,3H2;(H3,1,2,3,4).
What are the key properties of hydroxymethylphosphanium;acetate;phosphate?
hydroxymethylphosphanium;acetate;phosphate has a molecular weight of 414.14 g/mol, XLogP of -5.89, 0 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethylphosphanium;acetate;phosphate is sourced from PubChem (CID 163479536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).