About disodium;dihydrogen phosphate;acetate
disodium;dihydrogen phosphate;acetate (PubChem CID 86638819) has the molecular formula C2H5Na2O6P
and a molecular weight of 202.01 g/mol. Its IUPAC name is disodium;dihydrogen phosphate;acetate.
Molecular Properties
| Compound Name | disodium;dihydrogen phosphate;acetate |
| PubChem CID | 86638819 |
| Molecular Formula | C2H5Na2O6P |
| Molecular Weight | 202.01 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | disodium;dihydrogen phosphate;acetate |
| SMILES | CC(=O)[O-].O=P([O-])(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C2H4O2.2Na.H3O4P/c1-2(3)4;;;1-5(2,3)4/h1H3,(H,3,4);;;(H3,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | QTFZTELEUJQMCT-UHFFFAOYSA-L |
| XLogP | -8.80 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.01 |
| LogP ≤ 5 | -8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;dihydrogen phosphate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;dihydrogen phosphate;acetate?
The IUPAC name of disodium;dihydrogen phosphate;acetate (CID 86638819) is disodium;dihydrogen phosphate;acetate.
What is the SMILES notation for disodium;dihydrogen phosphate;acetate?
The canonical SMILES for disodium;dihydrogen phosphate;acetate is CC(=O)[O-].O=P([O-])(O)O.[Na+].[Na+].
What is the InChIKey of disodium;dihydrogen phosphate;acetate?
The InChIKey is QTFZTELEUJQMCT-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.2Na.H3O4P/c1-2(3)4;;;1-5(2,3)4/h1H3,(H,3,4);;;(H3,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;dihydrogen phosphate;acetate?
disodium;dihydrogen phosphate;acetate has a molecular weight of 202.01 g/mol, XLogP of -8.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;dihydrogen phosphate;acetate is sourced from PubChem (CID 86638819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).