About sodium;acetate;trihydrofluoride
sodium;acetate;trihydrofluoride (PubChem CID 172761892) has the molecular formula C2H6F3NaO2
and a molecular weight of 142.05 g/mol. Its IUPAC name is sodium;acetate;trihydrofluoride.
Molecular Properties
| Compound Name | sodium;acetate;trihydrofluoride |
| PubChem CID | 172761892 |
| Molecular Formula | C2H6F3NaO2 |
| Molecular Weight | 142.05 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | sodium;acetate;trihydrofluoride |
| SMILES | CC(=O)[O-].F.F.F.[Na+] |
| InChI | InChI=1S/C2H4O2.3FH.Na/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+1/p-1 |
| InChIKey | LUKAEGULILILON-UHFFFAOYSA-M |
| XLogP | -3.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.05 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;acetate;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetate;trihydrofluoride?
The IUPAC name of sodium;acetate;trihydrofluoride (CID 172761892) is sodium;acetate;trihydrofluoride.
What is the SMILES notation for sodium;acetate;trihydrofluoride?
The canonical SMILES for sodium;acetate;trihydrofluoride is CC(=O)[O-].F.F.F.[Na+].
What is the InChIKey of sodium;acetate;trihydrofluoride?
The InChIKey is LUKAEGULILILON-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.3FH.Na/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H;/q;;;;+1/p-1.
What are the key properties of sodium;acetate;trihydrofluoride?
sodium;acetate;trihydrofluoride has a molecular weight of 142.05 g/mol, XLogP of -3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetate;trihydrofluoride is sourced from PubChem (CID 172761892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).